C23H21ClF3NO3 — CID 142763691
N-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]-2-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 142763691) has the molecular formula C23H21ClF3NO3 and a molecular weight of 451.87 g/mol. Its IUPAC name is N-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]-2-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]-2-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 142763691 |
| Molecular Formula | C23H21ClF3NO3 |
| Molecular Weight | 451.87 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | N-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]-2-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(OC(F)(F)F)cc1)N[C@H]1CCC[C@@](O)(C#Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C23H21ClF3NO3/c24-18-4-1-3-16(13-18)10-12-22(30)11-2-5-19(15-22)28-21(29)14-17-6-8-20(9-7-17)31-23(25,26)27/h1,3-4,6-9,13,19,30H,2,5,11,14-15H2,(H,28,29)/t19-,22+/m0/s1 |
| InChIKey | BBCWJPCTDFUKAI-SIKLNZKXSA-N |
| XLogP | 4.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.87 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|