C18H23NO3 — CID 25257612
ethyl N-[(1S,3R)-3-hydroxy-3-[2-(3-methylphenyl)ethynyl]cyclohexyl]carbamate (PubChem CID 25257612) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is ethyl N-[(1S,3R)-3-hydroxy-3-[2-(3-methylphenyl)ethynyl]cyclohexyl]carbamate.
| Compound Name | ethyl N-[(1S,3R)-3-hydroxy-3-[2-(3-methylphenyl)ethynyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 25257612 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | ethyl N-[(1S,3R)-3-hydroxy-3-[2-(3-methylphenyl)ethynyl]cyclohexyl]carbamate |
| SMILES | CCOC(=O)N[C@H]1CCC[C@](O)(C#Cc2cccc(C)c2)C1 |
| InChI | InChI=1S/C18H23NO3/c1-3-22-17(20)19-16-8-5-10-18(21,13-16)11-9-15-7-4-6-14(2)12-15/h4,6-7,12,16,21H,3,5,8,10,13H2,1-2H3,(H,19,20)/t16-,18-/m0/s1 |
| InChIKey | OLWRARXBPQTFTR-WMZOPIPTSA-N |
| XLogP | 2.77 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|