C20H25NO3 — CID 90747564
N-[(1S,3R)-3-hydroxy-3-[2-(3-methylphenyl)ethynyl]cyclohexyl]oxolane-3-carboxamide (PubChem CID 90747564) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is N-[(1S,3R)-3-hydroxy-3-[2-(3-methylphenyl)ethynyl]cyclohexyl]oxolane-3-carboxamide.
| Compound Name | N-[(1S,3R)-3-hydroxy-3-[2-(3-methylphenyl)ethynyl]cyclohexyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 90747564 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-[(1S,3R)-3-hydroxy-3-[2-(3-methylphenyl)ethynyl]cyclohexyl]oxolane-3-carboxamide |
| SMILES | Cc1cccc(C#C[C@@]2(O)CCC[C@H](NC(=O)C3CCOC3)C2)c1 |
| InChI | InChI=1S/C20H25NO3/c1-15-4-2-5-16(12-15)7-10-20(23)9-3-6-18(13-20)21-19(22)17-8-11-24-14-17/h2,4-5,12,17-18,23H,3,6,8-9,11,13-14H2,1H3,(H,21,22)/t17?,18-,20-/m0/s1 |
| InChIKey | YMUGMWCQFRGNBW-WSTRIDTPSA-N |
| XLogP | 2.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|