C21H19ClFNO2 — CID 91256889
N-[(1S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]-2-fluorobenzamide (PubChem CID 91256889) has the molecular formula C21H19ClFNO2 and a molecular weight of 371.84 g/mol. Its IUPAC name is N-[(1S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]-2-fluorobenzamide.
| Compound Name | N-[(1S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 91256889 |
| Molecular Formula | C21H19ClFNO2 |
| Molecular Weight | 371.84 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-[(1S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]-2-fluorobenzamide |
| SMILES | O=C(N[C@H]1CCCC(O)(C#Cc2cccc(Cl)c2)C1)c1ccccc1F |
| InChI | InChI=1S/C21H19ClFNO2/c22-16-6-3-5-15(13-16)10-12-21(26)11-4-7-17(14-21)24-20(25)18-8-1-2-9-19(18)23/h1-3,5-6,8-9,13,17,26H,4,7,11,14H2,(H,24,25)/t17-,21?/m0/s1 |
| InChIKey | APHXLBYQJATABO-PBVYKCSPSA-N |
| XLogP | 3.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.84 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|