C15H16ClNO2 — CID 91479889
(1R)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexane-1-carboxamide (PubChem CID 91479889) has the molecular formula C15H16ClNO2 and a molecular weight of 277.75 g/mol. Its IUPAC name is (1R)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexane-1-carboxamide.
| Compound Name | (1R)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 91479889 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | (1R)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexane-1-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCC(O)(C#Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C15H16ClNO2/c16-13-5-1-3-11(9-13)6-8-15(19)7-2-4-12(10-15)14(17)18/h1,3,5,9,12,19H,2,4,7,10H2,(H2,17,18)/t12-,15?/m1/s1 |
| InChIKey | QMOUSCZCAFRBCT-KEKZHRQWSA-N |
| XLogP | 2.10 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|