C21H21ClN2O2 — CID 172850416
3-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]-6-methylpyridine-2-carboxamide (PubChem CID 172850416) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is 3-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]-6-methylpyridine-2-carboxamide.
| Compound Name | 3-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 172850416 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 3-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]-6-methylpyridine-2-carboxamide |
| SMILES | Cc1ccc([C@H]2CCC[C@@](O)(C#Cc3cccc(Cl)c3)C2)c(C(N)=O)n1 |
| InChI | InChI=1S/C21H21ClN2O2/c1-14-7-8-18(19(24-14)20(23)25)16-5-3-10-21(26,13-16)11-9-15-4-2-6-17(22)12-15/h2,4,6-8,12,16,26H,3,5,10,13H2,1H3,(H2,23,25)/t16-,21+/m0/s1 |
| InChIKey | XZJMXRDQQHDKQV-HRAATJIYSA-N |
| XLogP | 3.58 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|