C16H18ClNO3 — CID 11961000
methyl N-[4-[2-(3-chlorophenyl)ethynyl]-4-hydroxycyclohexyl]carbamate (PubChem CID 11961000) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is methyl N-[4-[2-(3-chlorophenyl)ethynyl]-4-hydroxycyclohexyl]carbamate.
| Compound Name | methyl N-[4-[2-(3-chlorophenyl)ethynyl]-4-hydroxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 11961000 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | methyl N-[4-[2-(3-chlorophenyl)ethynyl]-4-hydroxycyclohexyl]carbamate |
| SMILES | COC(=O)NC1CCC(O)(C#Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C16H18ClNO3/c1-21-15(19)18-14-6-9-16(20,10-7-14)8-5-12-3-2-4-13(17)11-12/h2-4,11,14,20H,6-7,9-10H2,1H3,(H,18,19) |
| InChIKey | PCPWOISXIWRRJO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|