C15H14O7S — CID 54486276
2-hydroxy-5-[2-(3-hydroxyphenyl)sulfonylethoxy]benzoic acid (PubChem CID 54486276) has the molecular formula C15H14O7S and a molecular weight of 338.34 g/mol. Its IUPAC name is 2-hydroxy-5-[2-(3-hydroxyphenyl)sulfonylethoxy]benzoic acid.
| Compound Name | 2-hydroxy-5-[2-(3-hydroxyphenyl)sulfonylethoxy]benzoic acid |
|---|---|
| PubChem CID | 54486276 |
| Molecular Formula | C15H14O7S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 2-hydroxy-5-[2-(3-hydroxyphenyl)sulfonylethoxy]benzoic acid |
| SMILES | O=C(O)c1cc(OCCS(=O)(=O)c2cccc(O)c2)ccc1O |
| InChI | InChI=1S/C15H14O7S/c16-10-2-1-3-12(8-10)23(20,21)7-6-22-11-4-5-14(17)13(9-11)15(18)19/h1-5,8-9,16-17H,6-7H2,(H,18,19) |
| InChIKey | XSNHTXKVNBMHMC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |