C15H13FO6S — CID 54007123
5-[2-(4-fluorophenyl)sulfonylethoxy]-2-hydroxybenzoic acid (PubChem CID 54007123) has the molecular formula C15H13FO6S and a molecular weight of 340.33 g/mol. Its IUPAC name is 5-[2-(4-fluorophenyl)sulfonylethoxy]-2-hydroxybenzoic acid.
| Compound Name | 5-[2-(4-fluorophenyl)sulfonylethoxy]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 54007123 |
| Molecular Formula | C15H13FO6S |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 5-[2-(4-fluorophenyl)sulfonylethoxy]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(OCCS(=O)(=O)c2ccc(F)cc2)ccc1O |
| InChI | InChI=1S/C15H13FO6S/c16-10-1-4-12(5-2-10)23(20,21)8-7-22-11-3-6-14(17)13(9-11)15(18)19/h1-6,9,17H,7-8H2,(H,18,19) |
| InChIKey | KPRHMXAWKJJORG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |