C8H7BrF2O2S — CID 84715319
1-bromo-4-(2,2-difluoroethylsulfonyl)benzene (PubChem CID 84715319) has the molecular formula C8H7BrF2O2S and a molecular weight of 285.11 g/mol. Its IUPAC name is 1-bromo-4-(2,2-difluoroethylsulfonyl)benzene.
| Compound Name | 1-bromo-4-(2,2-difluoroethylsulfonyl)benzene |
|---|---|
| PubChem CID | 84715319 |
| Molecular Formula | C8H7BrF2O2S |
| Molecular Weight | 285.11 g/mol |
| Exact Mass | 283.93 |
| IUPAC Name | 1-bromo-4-(2,2-difluoroethylsulfonyl)benzene |
| SMILES | O=S(=O)(CC(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C8H7BrF2O2S/c9-6-1-3-7(4-2-6)14(12,13)5-8(10)11/h1-4,8H,5H2 |
| InChIKey | TXTLVDIWENHGDG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.11 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |