C12H4ClF3N4O2S — CID 168608491
2-[2-chloro-5-(trifluoromethylsulfonyl)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168608491) has the molecular formula C12H4ClF3N4O2S and a molecular weight of 360.70 g/mol. Its IUPAC name is 2-[2-chloro-5-(trifluoromethylsulfonyl)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[2-chloro-5-(trifluoromethylsulfonyl)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608491 |
| Molecular Formula | C12H4ClF3N4O2S |
| Molecular Weight | 360.70 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | 2-[2-chloro-5-(trifluoromethylsulfonyl)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1cc(S(=O)(=O)C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C12H4ClF3N4O2S/c13-9-2-1-8(23(21,22)12(14,15)16)3-10(9)20-11(6-19)7(4-17)5-18/h1-3,20H |
| InChIKey | WXRZDVSQCCTFQS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.70 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|