C16H12ClF3N2O8S3 — CID 21209944
N-[2-chloro-5-(trifluoromethylsulfonyl)phenyl]-2-(4-methylsulfinyl-2-nitrophenyl)sulfonylacetamide (PubChem CID 21209944) has the molecular formula C16H12ClF3N2O8S3 and a molecular weight of 548.93 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethylsulfonyl)phenyl]-2-(4-methylsulfinyl-2-nitrophenyl)sulfonylacetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethylsulfonyl)phenyl]-2-(4-methylsulfinyl-2-nitrophenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 21209944 |
| Molecular Formula | C16H12ClF3N2O8S3 |
| Molecular Weight | 548.93 g/mol |
| Exact Mass | 547.94 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethylsulfonyl)phenyl]-2-(4-methylsulfinyl-2-nitrophenyl)sulfonylacetamide |
| SMILES | CS(=O)c1ccc(S(=O)(=O)CC(=O)Nc2cc(S(=O)(=O)C(F)(F)F)ccc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12ClF3N2O8S3/c1-31(26)9-2-5-14(13(6-9)22(24)25)32(27,28)8-15(23)21-12-7-10(3-4-11(12)17)33(29,30)16(18,19)20/h2-7H,8H2,1H3,(H,21,23) |
| InChIKey | GRAZZXVZIJXGCM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 157.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.93 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|