C16H12Cl2F3N3O5S — CID 26454011
N-(2,6-dichlorophenyl)-2-[N-methyl-2-nitro-4-(trifluoromethylsulfonyl)anilino]acetamide (PubChem CID 26454011) has the molecular formula C16H12Cl2F3N3O5S and a molecular weight of 486.26 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-[N-methyl-2-nitro-4-(trifluoromethylsulfonyl)anilino]acetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-[N-methyl-2-nitro-4-(trifluoromethylsulfonyl)anilino]acetamide |
|---|---|
| PubChem CID | 26454011 |
| Molecular Formula | C16H12Cl2F3N3O5S |
| Molecular Weight | 486.26 g/mol |
| Exact Mass | 484.98 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-[N-methyl-2-nitro-4-(trifluoromethylsulfonyl)anilino]acetamide |
| SMILES | CN(CC(=O)Nc1c(Cl)cccc1Cl)c1ccc(S(=O)(=O)C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12Cl2F3N3O5S/c1-23(8-14(25)22-15-10(17)3-2-4-11(15)18)12-6-5-9(7-13(12)24(26)27)30(28,29)16(19,20)21/h2-7H,8H2,1H3,(H,22,25) |
| InChIKey | LMYPKVOMCIQBGF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|