C17H20N4O5S — CID 18281198
N-(2,3-dimethylphenyl)-2-(N-methyl-2-nitro-4-sulfamoylanilino)acetamide (PubChem CID 18281198) has the molecular formula C17H20N4O5S and a molecular weight of 392.44 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-(N-methyl-2-nitro-4-sulfamoylanilino)acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-(N-methyl-2-nitro-4-sulfamoylanilino)acetamide |
|---|---|
| PubChem CID | 18281198 |
| Molecular Formula | C17H20N4O5S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-(N-methyl-2-nitro-4-sulfamoylanilino)acetamide |
| SMILES | Cc1cccc(NC(=O)CN(C)c2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C17H20N4O5S/c1-11-5-4-6-14(12(11)2)19-17(22)10-20(3)15-8-7-13(27(18,25)26)9-16(15)21(23)24/h4-9H,10H2,1-3H3,(H,19,22)(H2,18,25,26) |
| InChIKey | GKVGGCACCSHZDL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|