C21H26N4O5S2 — CID 4620773
2-(N-methyl-2-nitro-4-piperidin-1-ylsulfonylanilino)-N-(2-methylsulfanylphenyl)acetamide (PubChem CID 4620773) has the molecular formula C21H26N4O5S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 2-(N-methyl-2-nitro-4-piperidin-1-ylsulfonylanilino)-N-(2-methylsulfanylphenyl)acetamide.
| Compound Name | 2-(N-methyl-2-nitro-4-piperidin-1-ylsulfonylanilino)-N-(2-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 4620773 |
| Molecular Formula | C21H26N4O5S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 2-(N-methyl-2-nitro-4-piperidin-1-ylsulfonylanilino)-N-(2-methylsulfanylphenyl)acetamide |
| SMILES | CSc1ccccc1NC(=O)CN(C)c1ccc(S(=O)(=O)N2CCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H26N4O5S2/c1-23(15-21(26)22-17-8-4-5-9-20(17)31-2)18-11-10-16(14-19(18)25(27)28)32(29,30)24-12-6-3-7-13-24/h4-5,8-11,14H,3,6-7,12-13,15H2,1-2H3,(H,22,26) |
| InChIKey | UPNDWXYFBKFNLP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|