C20H23FN4O5S — CID 26453659
N-(3-fluorophenyl)-2-(N-methyl-2-nitro-4-piperidin-1-ylsulfonylanilino)acetamide (PubChem CID 26453659) has the molecular formula C20H23FN4O5S and a molecular weight of 450.49 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-(N-methyl-2-nitro-4-piperidin-1-ylsulfonylanilino)acetamide.
| Compound Name | N-(3-fluorophenyl)-2-(N-methyl-2-nitro-4-piperidin-1-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 26453659 |
| Molecular Formula | C20H23FN4O5S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-(3-fluorophenyl)-2-(N-methyl-2-nitro-4-piperidin-1-ylsulfonylanilino)acetamide |
| SMILES | CN(CC(=O)Nc1cccc(F)c1)c1ccc(S(=O)(=O)N2CCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23FN4O5S/c1-23(14-20(26)22-16-7-5-6-15(21)12-16)18-9-8-17(13-19(18)25(27)28)31(29,30)24-10-3-2-4-11-24/h5-9,12-13H,2-4,10-11,14H2,1H3,(H,22,26) |
| InChIKey | RCCAKZIFLJNJHA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|