C19H21BrFN3O3S — CID 60585244
2-(4-bromo-2-fluoro-N-methylanilino)-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 60585244) has the molecular formula C19H21BrFN3O3S and a molecular weight of 470.36 g/mol. Its IUPAC name is 2-(4-bromo-2-fluoro-N-methylanilino)-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(4-bromo-2-fluoro-N-methylanilino)-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 60585244 |
| Molecular Formula | C19H21BrFN3O3S |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 2-(4-bromo-2-fluoro-N-methylanilino)-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1)c1ccc(Br)cc1F |
| InChI | InChI=1S/C19H21BrFN3O3S/c1-23(18-8-7-14(20)11-17(18)21)13-19(25)22-15-5-4-6-16(12-15)28(26,27)24-9-2-3-10-24/h4-8,11-12H,2-3,9-10,13H2,1H3,(H,22,25) |
| InChIKey | SKSCBCUUAWLBBQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |