C22H29N3O5S — CID 96521916
(3R)-3-[4-(azepan-1-ylsulfonyl)-N-methyl-2-nitroanilino]-3-phenylpropan-1-ol (PubChem CID 96521916) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is (3R)-3-[4-(azepan-1-ylsulfonyl)-N-methyl-2-nitroanilino]-3-phenylpropan-1-ol.
| Compound Name | (3R)-3-[4-(azepan-1-ylsulfonyl)-N-methyl-2-nitroanilino]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 96521916 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (3R)-3-[4-(azepan-1-ylsulfonyl)-N-methyl-2-nitroanilino]-3-phenylpropan-1-ol |
| SMILES | CN(c1ccc(S(=O)(=O)N2CCCCCC2)cc1[N+](=O)[O-])[C@H](CCO)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O5S/c1-23(20(13-16-26)18-9-5-4-6-10-18)21-12-11-19(17-22(21)25(27)28)31(29,30)24-14-7-2-3-8-15-24/h4-6,9-12,17,20,26H,2-3,7-8,13-16H2,1H3/t20-/m1/s1 |
| InChIKey | LJWLOZTWGBJWLR-HXUWFJFHSA-N |
| XLogP | 3.72 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|