C16H14Cl2N4O4 — CID 9182724
4-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-3-nitrobenzamide (PubChem CID 9182724) has the molecular formula C16H14Cl2N4O4 and a molecular weight of 397.22 g/mol. Its IUPAC name is 4-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-3-nitrobenzamide.
| Compound Name | 4-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 9182724 |
| Molecular Formula | C16H14Cl2N4O4 |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 4-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-3-nitrobenzamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(Cl)c1)c1ccc(C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14Cl2N4O4/c1-21(8-15(23)20-10-3-4-11(17)12(18)7-10)13-5-2-9(16(19)24)6-14(13)22(25)26/h2-7H,8H2,1H3,(H2,19,24)(H,20,23) |
| InChIKey | VJCLRKAJQKLIFJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|