C20H20ClF3N4O4 — CID 46560138
4-[[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-methylamino]-3-nitro-N-propan-2-ylbenzamide (PubChem CID 46560138) has the molecular formula C20H20ClF3N4O4 and a molecular weight of 472.85 g/mol. Its IUPAC name is 4-[[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-methylamino]-3-nitro-N-propan-2-ylbenzamide.
| Compound Name | 4-[[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-methylamino]-3-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 46560138 |
| Molecular Formula | C20H20ClF3N4O4 |
| Molecular Weight | 472.85 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 4-[[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-methylamino]-3-nitro-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(N(C)CC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20ClF3N4O4/c1-11(2)25-19(30)12-4-7-16(17(8-12)28(31)32)27(3)10-18(29)26-13-5-6-15(21)14(9-13)20(22,23)24/h4-9,11H,10H2,1-3H3,(H,25,30)(H,26,29) |
| InChIKey | HAQWDHIUGBBFRN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.85 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|