C19H17Cl2F3N4O4 — CID 2542503
(2S)-N-(2-chloro-5-nitrophenyl)-2-[[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-methylamino]propanamide (PubChem CID 2542503) has the molecular formula C19H17Cl2F3N4O4 and a molecular weight of 493.27 g/mol. Its IUPAC name is (2S)-N-(2-chloro-5-nitrophenyl)-2-[[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-methylamino]propanamide.
| Compound Name | (2S)-N-(2-chloro-5-nitrophenyl)-2-[[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-methylamino]propanamide |
|---|---|
| PubChem CID | 2542503 |
| Molecular Formula | C19H17Cl2F3N4O4 |
| Molecular Weight | 493.27 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | (2S)-N-(2-chloro-5-nitrophenyl)-2-[[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-methylamino]propanamide |
| SMILES | C[C@@H](C(=O)Nc1cc([N+](=O)[O-])ccc1Cl)N(C)CC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17Cl2F3N4O4/c1-10(18(30)26-16-8-12(28(31)32)4-6-15(16)21)27(2)9-17(29)25-11-3-5-14(20)13(7-11)19(22,23)24/h3-8,10H,9H2,1-2H3,(H,25,29)(H,26,30)/t10-/m0/s1 |
| InChIKey | KWUTZZYGMZUSKA-JTQLQIEISA-N |
| XLogP | 4.82 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.27 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|