C17H17ClF3N5O4 — CID 86881317
N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-N,2-dimethyl-2-(4-nitropyrazol-1-yl)propanamide (PubChem CID 86881317) has the molecular formula C17H17ClF3N5O4 and a molecular weight of 447.80 g/mol. Its IUPAC name is N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-N,2-dimethyl-2-(4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-N,2-dimethyl-2-(4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 86881317 |
| Molecular Formula | C17H17ClF3N5O4 |
| Molecular Weight | 447.80 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-N,2-dimethyl-2-(4-nitropyrazol-1-yl)propanamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)C(=O)C(C)(C)n1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C17H17ClF3N5O4/c1-16(2,25-8-11(7-22-25)26(29)30)15(28)24(3)9-14(27)23-10-4-5-13(18)12(6-10)17(19,20)21/h4-8H,9H2,1-3H3,(H,23,27) |
| InChIKey | WIYRUEVGUGXRSS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|