C20H20ClF3N4O5 — CID 4967366
2-[[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-methylamino]-N-(2-methoxy-5-nitrophenyl)propanamide (PubChem CID 4967366) has the molecular formula C20H20ClF3N4O5 and a molecular weight of 488.85 g/mol. Its IUPAC name is 2-[[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-methylamino]-N-(2-methoxy-5-nitrophenyl)propanamide.
| Compound Name | 2-[[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-methylamino]-N-(2-methoxy-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 4967366 |
| Molecular Formula | C20H20ClF3N4O5 |
| Molecular Weight | 488.85 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 2-[[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-methylamino]-N-(2-methoxy-5-nitrophenyl)propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C(C)N(C)CC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H20ClF3N4O5/c1-11(19(30)26-16-9-13(28(31)32)5-7-17(16)33-3)27(2)10-18(29)25-12-4-6-15(21)14(8-12)20(22,23)24/h4-9,11H,10H2,1-3H3,(H,25,29)(H,26,30) |
| InChIKey | PCEUPGHBPDTMJF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.85 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|