C19H23N5O5 — CID 52512652
(2R)-N-(2-methoxy-5-nitrophenyl)-2-[methyl-[2-[(5-methyl-2-pyridinyl)amino]-2-oxoethyl]amino]propanamide (PubChem CID 52512652) has the molecular formula C19H23N5O5 and a molecular weight of 401.42 g/mol. Its IUPAC name is (2R)-N-(2-methoxy-5-nitrophenyl)-2-[methyl-[2-[(5-methyl-2-pyridinyl)amino]-2-oxoethyl]amino]propanamide.
| Compound Name | (2R)-N-(2-methoxy-5-nitrophenyl)-2-[methyl-[2-[(5-methyl-2-pyridinyl)amino]-2-oxoethyl]amino]propanamide |
|---|---|
| PubChem CID | 52512652 |
| Molecular Formula | C19H23N5O5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | (2R)-N-(2-methoxy-5-nitrophenyl)-2-[methyl-[2-[(5-methyl-2-pyridinyl)amino]-2-oxoethyl]amino]propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H](C)N(C)CC(=O)Nc1ccc(C)cn1 |
| InChI | InChI=1S/C19H23N5O5/c1-12-5-8-17(20-10-12)22-18(25)11-23(3)13(2)19(26)21-15-9-14(24(27)28)6-7-16(15)29-4/h5-10,13H,11H2,1-4H3,(H,21,26)(H,20,22,25)/t13-/m1/s1 |
| InChIKey | NUPLOAYWCMLDJR-CYBMUJFWSA-N |
| XLogP | 2.20 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|