C18H17Cl3N4O4 — CID 41093919
(2S)-N-(2-chloro-5-nitrophenyl)-2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]propanamide (PubChem CID 41093919) has the molecular formula C18H17Cl3N4O4 and a molecular weight of 459.72 g/mol. Its IUPAC name is (2S)-N-(2-chloro-5-nitrophenyl)-2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]propanamide.
| Compound Name | (2S)-N-(2-chloro-5-nitrophenyl)-2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]propanamide |
|---|---|
| PubChem CID | 41093919 |
| Molecular Formula | C18H17Cl3N4O4 |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | (2S)-N-(2-chloro-5-nitrophenyl)-2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]propanamide |
| SMILES | C[C@@H](C(=O)Nc1cc([N+](=O)[O-])ccc1Cl)N(C)CC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H17Cl3N4O4/c1-10(18(27)23-16-8-12(25(28)29)4-6-14(16)20)24(2)9-17(26)22-11-3-5-13(19)15(21)7-11/h3-8,10H,9H2,1-2H3,(H,22,26)(H,23,27)/t10-/m0/s1 |
| InChIKey | GXKNXQJNHQIFBT-JTQLQIEISA-N |
| XLogP | 4.45 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|