C14H14N4O3S — CID 19686414
1-(2-methoxy-5-methylphenyl)-3-(5-nitro-2-pyridinyl)thiourea (PubChem CID 19686414) has the molecular formula C14H14N4O3S and a molecular weight of 318.36 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-3-(5-nitro-2-pyridinyl)thiourea.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-3-(5-nitro-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 19686414 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-3-(5-nitro-2-pyridinyl)thiourea |
| SMILES | COc1ccc(C)cc1NC(=S)Nc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C14H14N4O3S/c1-9-3-5-12(21-2)11(7-9)16-14(22)17-13-6-4-10(8-15-13)18(19)20/h3-8H,1-2H3,(H2,15,16,17,22) |
| InChIKey | TYINEARNSZBNQJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|