C14H14N4O4S — CID 19686409
1-(3,4-dimethoxyphenyl)-3-(5-nitro-2-pyridinyl)thiourea (PubChem CID 19686409) has the molecular formula C14H14N4O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-(5-nitro-2-pyridinyl)thiourea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-(5-nitro-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 19686409 |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(5-nitro-2-pyridinyl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccc([N+](=O)[O-])cn2)cc1OC |
| InChI | InChI=1S/C14H14N4O4S/c1-21-11-5-3-9(7-12(11)22-2)16-14(23)17-13-6-4-10(8-15-13)18(19)20/h3-8H,1-2H3,(H2,15,16,17,23) |
| InChIKey | QVXUQTDQFDFRPZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|