C20H18ClF3N4O4 — CID 112791866
N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-4-(cyclopropylamino)-N-methyl-3-nitrobenzamide (PubChem CID 112791866) has the molecular formula C20H18ClF3N4O4 and a molecular weight of 470.84 g/mol. Its IUPAC name is N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-4-(cyclopropylamino)-N-methyl-3-nitrobenzamide.
| Compound Name | N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-4-(cyclopropylamino)-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 112791866 |
| Molecular Formula | C20H18ClF3N4O4 |
| Molecular Weight | 470.84 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-4-(cyclopropylamino)-N-methyl-3-nitrobenzamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)C(=O)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18ClF3N4O4/c1-27(10-18(29)26-13-5-6-15(21)14(9-13)20(22,23)24)19(30)11-2-7-16(25-12-3-4-12)17(8-11)28(31)32/h2,5-9,12,25H,3-4,10H2,1H3,(H,26,29) |
| InChIKey | KGWHIZXEFZUNFE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.84 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|