C17H24N4O4 — CID 9225803
4-(cyclopropylamino)-N-[2-(diethylamino)-2-oxoethyl]-N-methyl-3-nitrobenzamide (PubChem CID 9225803) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-[2-(diethylamino)-2-oxoethyl]-N-methyl-3-nitrobenzamide.
| Compound Name | 4-(cyclopropylamino)-N-[2-(diethylamino)-2-oxoethyl]-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 9225803 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 4-(cyclopropylamino)-N-[2-(diethylamino)-2-oxoethyl]-N-methyl-3-nitrobenzamide |
| SMILES | CCN(CC)C(=O)CN(C)C(=O)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H24N4O4/c1-4-20(5-2)16(22)11-19(3)17(23)12-6-9-14(18-13-7-8-13)15(10-12)21(24)25/h6,9-10,13,18H,4-5,7-8,11H2,1-3H3 |
| InChIKey | AAIAXKQQYPJVTI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|