C20H21BrN4O4 — CID 26678347
N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-4-(cyclopropylamino)-N-methyl-3-nitrobenzamide (PubChem CID 26678347) has the molecular formula C20H21BrN4O4 and a molecular weight of 461.32 g/mol. Its IUPAC name is N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-4-(cyclopropylamino)-N-methyl-3-nitrobenzamide.
| Compound Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-4-(cyclopropylamino)-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 26678347 |
| Molecular Formula | C20H21BrN4O4 |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-4-(cyclopropylamino)-N-methyl-3-nitrobenzamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN(C)C(=O)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21BrN4O4/c1-12-9-14(21)4-8-16(12)23-19(26)11-24(2)20(27)13-3-7-17(22-15-5-6-15)18(10-13)25(28)29/h3-4,7-10,15,22H,5-6,11H2,1-2H3,(H,23,26) |
| InChIKey | RYONKZDFWWWWNH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|