C21H24N4O4 — CID 26713720
4-(cyclopropylamino)-3-nitro-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide (PubChem CID 26713720) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 4-(cyclopropylamino)-3-nitro-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide.
| Compound Name | 4-(cyclopropylamino)-3-nitro-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 26713720 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 4-(cyclopropylamino)-3-nitro-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)c2ccc(NC3CC3)c([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C21H24N4O4/c1-12-8-13(2)20(14(3)9-12)24-19(26)11-22-21(27)15-4-7-17(23-16-5-6-16)18(10-15)25(28)29/h4,7-10,16,23H,5-6,11H2,1-3H3,(H,22,27)(H,24,26) |
| InChIKey | QKEQRJKMGKMQKJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|