C19H17N3O3 — CID 51332433
4-(cyclopropylamino)-3-nitro-N-(3-phenylprop-2-ynyl)benzamide (PubChem CID 51332433) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 4-(cyclopropylamino)-3-nitro-N-(3-phenylprop-2-ynyl)benzamide.
| Compound Name | 4-(cyclopropylamino)-3-nitro-N-(3-phenylprop-2-ynyl)benzamide |
|---|---|
| PubChem CID | 51332433 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 4-(cyclopropylamino)-3-nitro-N-(3-phenylprop-2-ynyl)benzamide |
| SMILES | O=C(NCC#Cc1ccccc1)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17N3O3/c23-19(20-12-4-7-14-5-2-1-3-6-14)15-8-11-17(21-16-9-10-16)18(13-15)22(24)25/h1-3,5-6,8,11,13,16,21H,9-10,12H2,(H,20,23) |
| InChIKey | CEUXPJLAUGUJEF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|