C22H17Cl2N3O4 — CID 26454015
2-(4-benzoyl-N-methyl-2-nitroanilino)-N-(2,6-dichlorophenyl)acetamide (PubChem CID 26454015) has the molecular formula C22H17Cl2N3O4 and a molecular weight of 458.30 g/mol. Its IUPAC name is 2-(4-benzoyl-N-methyl-2-nitroanilino)-N-(2,6-dichlorophenyl)acetamide.
| Compound Name | 2-(4-benzoyl-N-methyl-2-nitroanilino)-N-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 26454015 |
| Molecular Formula | C22H17Cl2N3O4 |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | 2-(4-benzoyl-N-methyl-2-nitroanilino)-N-(2,6-dichlorophenyl)acetamide |
| SMILES | CN(CC(=O)Nc1c(Cl)cccc1Cl)c1ccc(C(=O)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H17Cl2N3O4/c1-26(13-20(28)25-21-16(23)8-5-9-17(21)24)18-11-10-15(12-19(18)27(30)31)22(29)14-6-3-2-4-7-14/h2-12H,13H2,1H3,(H,25,28) |
| InChIKey | LKBKPWVDICWOEU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|