C16H14Cl2N4O4 — CID 27807402
4-amino-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-3-nitrobenzamide (PubChem CID 27807402) has the molecular formula C16H14Cl2N4O4 and a molecular weight of 397.22 g/mol. Its IUPAC name is 4-amino-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-3-nitrobenzamide.
| Compound Name | 4-amino-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 27807402 |
| Molecular Formula | C16H14Cl2N4O4 |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 4-amino-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-3-nitrobenzamide |
| SMILES | CN(CC(=O)Nc1c(Cl)cccc1Cl)C(=O)c1ccc(N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H14Cl2N4O4/c1-21(8-14(23)20-15-10(17)3-2-4-11(15)18)16(24)9-5-6-12(19)13(7-9)22(25)26/h2-7H,8,19H2,1H3,(H,20,23) |
| InChIKey | VKUHUETVJPQAOW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|