C19H16F7N3O4 — CID 132829252
4-(dimethylamino)-3-nitro-N-[4-(2,2,3,3-tetrafluoropropoxy)-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 132829252) has the molecular formula C19H16F7N3O4 and a molecular weight of 483.34 g/mol. Its IUPAC name is 4-(dimethylamino)-3-nitro-N-[4-(2,2,3,3-tetrafluoropropoxy)-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-(dimethylamino)-3-nitro-N-[4-(2,2,3,3-tetrafluoropropoxy)-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 132829252 |
| Molecular Formula | C19H16F7N3O4 |
| Molecular Weight | 483.34 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 4-(dimethylamino)-3-nitro-N-[4-(2,2,3,3-tetrafluoropropoxy)-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CN(C)c1ccc(C(=O)Nc2ccc(OCC(F)(F)C(F)F)c(C(F)(F)F)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16F7N3O4/c1-28(2)13-5-3-10(7-14(13)29(31)32)16(30)27-11-4-6-15(12(8-11)19(24,25)26)33-9-18(22,23)17(20)21/h3-8,17H,9H2,1-2H3,(H,27,30) |
| InChIKey | LMZIPABBTKAYSA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.34 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|