C21H24N4O5 — CID 9181628
2-(4-acetyl-N-methyl-2-nitroanilino)-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 9181628) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-(4-acetyl-N-methyl-2-nitroanilino)-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(4-acetyl-N-methyl-2-nitroanilino)-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 9181628 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-(4-acetyl-N-methyl-2-nitroanilino)-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CC(=O)c1ccc(N(C)CC(=O)Nc2ccc(N3CCOCC3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H24N4O5/c1-15(26)16-3-8-19(20(13-16)25(28)29)23(2)14-21(27)22-17-4-6-18(7-5-17)24-9-11-30-12-10-24/h3-8,13H,9-12,14H2,1-2H3,(H,22,27) |
| InChIKey | ZFKVEVNZWAIZAV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|