C20H25N7O4 — CID 55591008
2-[[4-(cyclopropylamino)-5-nitropyrimidin-2-yl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 55591008) has the molecular formula C20H25N7O4 and a molecular weight of 427.47 g/mol. Its IUPAC name is 2-[[4-(cyclopropylamino)-5-nitropyrimidin-2-yl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[[4-(cyclopropylamino)-5-nitropyrimidin-2-yl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55591008 |
| Molecular Formula | C20H25N7O4 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 2-[[4-(cyclopropylamino)-5-nitropyrimidin-2-yl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(N2CCOCC2)cc1)c1ncc([N+](=O)[O-])c(NC2CC2)n1 |
| InChI | InChI=1S/C20H25N7O4/c1-25(20-21-12-17(27(29)30)19(24-20)23-15-2-3-15)13-18(28)22-14-4-6-16(7-5-14)26-8-10-31-11-9-26/h4-7,12,15H,2-3,8-11,13H2,1H3,(H,22,28)(H,21,23,24) |
| InChIKey | YIMXPQUMJJAYIS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|