C10H10F3NO3S — CID 825465
N-[2-methyl-5-(trifluoromethylsulfonyl)phenyl]acetamide (PubChem CID 825465) has the molecular formula C10H10F3NO3S and a molecular weight of 281.26 g/mol. Its IUPAC name is N-[2-methyl-5-(trifluoromethylsulfonyl)phenyl]acetamide.
| Compound Name | N-[2-methyl-5-(trifluoromethylsulfonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 825465 |
| Molecular Formula | C10H10F3NO3S |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | N-[2-methyl-5-(trifluoromethylsulfonyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(S(=O)(=O)C(F)(F)F)ccc1C |
| InChI | InChI=1S/C10H10F3NO3S/c1-6-3-4-8(5-9(6)14-7(2)15)18(16,17)10(11,12)13/h3-5H,1-2H3,(H,14,15) |
| InChIKey | NHPLIQPERVVQHK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |