C10H11F3N2O3S — CID 61130873
3,3,3-trifluoro-N-(2-methyl-5-sulfamoylphenyl)propanamide (PubChem CID 61130873) has the molecular formula C10H11F3N2O3S and a molecular weight of 296.27 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-(2-methyl-5-sulfamoylphenyl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-(2-methyl-5-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 61130873 |
| Molecular Formula | C10H11F3N2O3S |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 3,3,3-trifluoro-N-(2-methyl-5-sulfamoylphenyl)propanamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1NC(=O)CC(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O3S/c1-6-2-3-7(19(14,17)18)4-8(6)15-9(16)5-10(11,12)13/h2-4H,5H2,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | GBEIGNZYKRSQDB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |