C13H20N2O3S — CID 55103402
2,2-dimethyl-N-(2-methyl-5-sulfamoylphenyl)butanamide (PubChem CID 55103402) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2-methyl-5-sulfamoylphenyl)butanamide.
| Compound Name | 2,2-dimethyl-N-(2-methyl-5-sulfamoylphenyl)butanamide |
|---|---|
| PubChem CID | 55103402 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2,2-dimethyl-N-(2-methyl-5-sulfamoylphenyl)butanamide |
| SMILES | CCC(C)(C)C(=O)Nc1cc(S(N)(=O)=O)ccc1C |
| InChI | InChI=1S/C13H20N2O3S/c1-5-13(3,4)12(16)15-11-8-10(19(14,17)18)7-6-9(11)2/h6-8H,5H2,1-4H3,(H,15,16)(H2,14,17,18) |
| InChIKey | FVBDXUSSYZJOHI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |