C12H17FN2O3S — CID 62677323
N-(2-fluoro-5-sulfamoylphenyl)-2,2-dimethylbutanamide (PubChem CID 62677323) has the molecular formula C12H17FN2O3S and a molecular weight of 288.34 g/mol. Its IUPAC name is N-(2-fluoro-5-sulfamoylphenyl)-2,2-dimethylbutanamide.
| Compound Name | N-(2-fluoro-5-sulfamoylphenyl)-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 62677323 |
| Molecular Formula | C12H17FN2O3S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-(2-fluoro-5-sulfamoylphenyl)-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1cc(S(N)(=O)=O)ccc1F |
| InChI | InChI=1S/C12H17FN2O3S/c1-4-12(2,3)11(16)15-10-7-8(19(14,17)18)5-6-9(10)13/h5-7H,4H2,1-3H3,(H,15,16)(H2,14,17,18) |
| InChIKey | TYAZVMLODWKGMC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |