C9H11FN2O3S2 — CID 61129990
N-(2-fluoro-5-sulfamoylphenyl)-2-methylsulfanylacetamide (PubChem CID 61129990) has the molecular formula C9H11FN2O3S2 and a molecular weight of 278.33 g/mol. Its IUPAC name is N-(2-fluoro-5-sulfamoylphenyl)-2-methylsulfanylacetamide.
| Compound Name | N-(2-fluoro-5-sulfamoylphenyl)-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 61129990 |
| Molecular Formula | C9H11FN2O3S2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | N-(2-fluoro-5-sulfamoylphenyl)-2-methylsulfanylacetamide |
| SMILES | CSCC(=O)Nc1cc(S(N)(=O)=O)ccc1F |
| InChI | InChI=1S/C9H11FN2O3S2/c1-16-5-9(13)12-8-4-6(17(11,14)15)2-3-7(8)10/h2-4H,5H2,1H3,(H,12,13)(H2,11,14,15) |
| InChIKey | DEGIHKDKDICVGS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |