C12H16FNO4S — CID 65143064
tert-butyl N-(2-fluoro-5-methylsulfonylphenyl)carbamate (PubChem CID 65143064) has the molecular formula C12H16FNO4S and a molecular weight of 289.33 g/mol. Its IUPAC name is tert-butyl N-(2-fluoro-5-methylsulfonylphenyl)carbamate.
| Compound Name | tert-butyl N-(2-fluoro-5-methylsulfonylphenyl)carbamate |
|---|---|
| PubChem CID | 65143064 |
| Molecular Formula | C12H16FNO4S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | tert-butyl N-(2-fluoro-5-methylsulfonylphenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C12H16FNO4S/c1-12(2,3)18-11(15)14-10-7-8(19(4,16)17)5-6-9(10)13/h5-7H,1-4H3,(H,14,15) |
| InChIKey | DOTJETSXKGZPQP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |