C13H14FNO5 — CID 117455185
2-[4-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-2-oxoacetic acid (PubChem CID 117455185) has the molecular formula C13H14FNO5 and a molecular weight of 283.25 g/mol. Its IUPAC name is 2-[4-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-2-oxoacetic acid.
| Compound Name | 2-[4-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 117455185 |
| Molecular Formula | C13H14FNO5 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-[4-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-2-oxoacetic acid |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C(=O)C(=O)O)ccc1F |
| InChI | InChI=1S/C13H14FNO5/c1-13(2,3)20-12(19)15-9-6-7(4-5-8(9)14)10(16)11(17)18/h4-6H,1-3H3,(H,15,19)(H,17,18) |
| InChIKey | WFDOJLXNHLOKSY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|