C19H17FN2O3 — CID 166606828
tert-butyl N-[5-(4-cyanobenzoyl)-2-fluorophenyl]carbamate (PubChem CID 166606828) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is tert-butyl N-[5-(4-cyanobenzoyl)-2-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[5-(4-cyanobenzoyl)-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 166606828 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | tert-butyl N-[5-(4-cyanobenzoyl)-2-fluorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C(=O)c2ccc(C#N)cc2)ccc1F |
| InChI | InChI=1S/C19H17FN2O3/c1-19(2,3)25-18(24)22-16-10-14(8-9-15(16)20)17(23)13-6-4-12(11-21)5-7-13/h4-10H,1-3H3,(H,22,24) |
| InChIKey | HEDDYVODKMBMSA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |