C11H12Cl2FNO2 — CID 68582591
tert-butyl N-(2,3-dichloro-4-fluorophenyl)carbamate (PubChem CID 68582591) has the molecular formula C11H12Cl2FNO2 and a molecular weight of 280.13 g/mol. Its IUPAC name is tert-butyl N-(2,3-dichloro-4-fluorophenyl)carbamate.
| Compound Name | tert-butyl N-(2,3-dichloro-4-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 68582591 |
| Molecular Formula | C11H12Cl2FNO2 |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | tert-butyl N-(2,3-dichloro-4-fluorophenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(F)c(Cl)c1Cl |
| InChI | InChI=1S/C11H12Cl2FNO2/c1-11(2,3)17-10(16)15-7-5-4-6(14)8(12)9(7)13/h4-5H,1-3H3,(H,15,16) |
| InChIKey | OXSPSGXCCFKUMD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|