C15H19ClFNO3 — CID 164842667
tert-butyl N-[2-chloro-4-(1-ethoxyethenyl)-3-fluorophenyl]carbamate (PubChem CID 164842667) has the molecular formula C15H19ClFNO3 and a molecular weight of 315.77 g/mol. Its IUPAC name is tert-butyl N-[2-chloro-4-(1-ethoxyethenyl)-3-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[2-chloro-4-(1-ethoxyethenyl)-3-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 164842667 |
| Molecular Formula | C15H19ClFNO3 |
| Molecular Weight | 315.77 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | tert-butyl N-[2-chloro-4-(1-ethoxyethenyl)-3-fluorophenyl]carbamate |
| SMILES | C=C(OCC)c1ccc(NC(=O)OC(C)(C)C)c(Cl)c1F |
| InChI | InChI=1S/C15H19ClFNO3/c1-6-20-9(2)10-7-8-11(12(16)13(10)17)18-14(19)21-15(3,4)5/h7-8H,2,6H2,1,3-5H3,(H,18,19) |
| InChIKey | NZOYIYIRRKLTGF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.77 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|