C16H20F3NO3 — CID 164842670
tert-butyl N-[4-(1-ethoxyethenyl)-2-(trifluoromethyl)phenyl]carbamate (PubChem CID 164842670) has the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. Its IUPAC name is tert-butyl N-[4-(1-ethoxyethenyl)-2-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(1-ethoxyethenyl)-2-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 164842670 |
| Molecular Formula | C16H20F3NO3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | tert-butyl N-[4-(1-ethoxyethenyl)-2-(trifluoromethyl)phenyl]carbamate |
| SMILES | C=C(OCC)c1ccc(NC(=O)OC(C)(C)C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H20F3NO3/c1-6-22-10(2)11-7-8-13(12(9-11)16(17,18)19)20-14(21)23-15(3,4)5/h7-9H,2,6H2,1,3-5H3,(H,20,21) |
| InChIKey | ZXJFOAIOSFTBAR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|