C18H28F3N3O4 — CID 102530973
tert-butyl N-[2-[2-[2-[4-amino-2-(trifluoromethyl)anilino]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 102530973) has the molecular formula C18H28F3N3O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[4-amino-2-(trifluoromethyl)anilino]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[4-amino-2-(trifluoromethyl)anilino]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 102530973 |
| Molecular Formula | C18H28F3N3O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[4-amino-2-(trifluoromethyl)anilino]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCNc1ccc(N)cc1C(F)(F)F |
| InChI | InChI=1S/C18H28F3N3O4/c1-17(2,3)28-16(25)24-7-9-27-11-10-26-8-6-23-15-5-4-13(22)12-14(15)18(19,20)21/h4-5,12,23H,6-11,22H2,1-3H3,(H,24,25) |
| InChIKey | GYVWJXDTSJPEQB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|