C17H22F3NO3 — CID 167066827
tert-butyl N-[4-(1-propoxyethenyl)-2-(trifluoromethyl)phenyl]carbamate (PubChem CID 167066827) has the molecular formula C17H22F3NO3 and a molecular weight of 345.36 g/mol. Its IUPAC name is tert-butyl N-[4-(1-propoxyethenyl)-2-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(1-propoxyethenyl)-2-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 167066827 |
| Molecular Formula | C17H22F3NO3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | tert-butyl N-[4-(1-propoxyethenyl)-2-(trifluoromethyl)phenyl]carbamate |
| SMILES | C=C(OCCC)c1ccc(NC(=O)OC(C)(C)C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H22F3NO3/c1-6-9-23-11(2)12-7-8-14(13(10-12)17(18,19)20)21-15(22)24-16(3,4)5/h7-8,10H,2,6,9H2,1,3-5H3,(H,21,22) |
| InChIKey | NBYYBNKHWBMXJD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|